C16H25N3O — CID 91659969
2-methyl-4-[1-(4-methyl-2-pyridinyl)piperidin-4-yl]morpholine (PubChem CID 91659969) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-methyl-4-[1-(4-methyl-2-pyridinyl)piperidin-4-yl]morpholine.
| Compound Name | 2-methyl-4-[1-(4-methyl-2-pyridinyl)piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 91659969 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 2-methyl-4-[1-(4-methyl-2-pyridinyl)piperidin-4-yl]morpholine |
| SMILES | Cc1ccnc(N2CCC(N3CCOC(C)C3)CC2)c1 |
| InChI | InChI=1S/C16H25N3O/c1-13-3-6-17-16(11-13)18-7-4-15(5-8-18)19-9-10-20-14(2)12-19/h3,6,11,14-15H,4-5,7-10,12H2,1-2H3 |
| InChIKey | PWLCQVUUUPCZKC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |