C12H16F2N2 — CID 171993927
2-[4-(difluoromethyl)piperidin-1-yl]-4-methylpyridine (PubChem CID 171993927) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)piperidin-1-yl]-4-methylpyridine.
| Compound Name | 2-[4-(difluoromethyl)piperidin-1-yl]-4-methylpyridine |
|---|---|
| PubChem CID | 171993927 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-[4-(difluoromethyl)piperidin-1-yl]-4-methylpyridine |
| SMILES | Cc1ccnc(N2CCC(C(F)F)CC2)c1 |
| InChI | InChI=1S/C12H16F2N2/c1-9-2-5-15-11(8-9)16-6-3-10(4-7-16)12(13)14/h2,5,8,10,12H,3-4,6-7H2,1H3 |
| InChIKey | MEIMLGFLCIHQBR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |