C13H22ClN3 — CID 22064868
2-[1-(4-methyl-2-pyridinyl)piperidin-4-yl]ethanamine;hydrochloride (PubChem CID 22064868) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is 2-[1-(4-methyl-2-pyridinyl)piperidin-4-yl]ethanamine;hydrochloride.
| Compound Name | 2-[1-(4-methyl-2-pyridinyl)piperidin-4-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 22064868 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-[1-(4-methyl-2-pyridinyl)piperidin-4-yl]ethanamine;hydrochloride |
| SMILES | Cc1ccnc(N2CCC(CCN)CC2)c1.Cl |
| InChI | InChI=1S/C13H21N3.ClH/c1-11-3-7-15-13(10-11)16-8-4-12(2-6-14)5-9-16;/h3,7,10,12H,2,4-6,8-9,14H2,1H3;1H |
| InChIKey | JOQVSLMACDXDLE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |