C16H30N2 — CID 170578415
ethane;2-(3-ethylpyrrolidin-1-yl)-4-methylpyridine (PubChem CID 170578415) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is ethane;2-(3-ethylpyrrolidin-1-yl)-4-methylpyridine.
| Compound Name | ethane;2-(3-ethylpyrrolidin-1-yl)-4-methylpyridine |
|---|---|
| PubChem CID | 170578415 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | ethane;2-(3-ethylpyrrolidin-1-yl)-4-methylpyridine |
| SMILES | CC.CC.CCC1CCN(c2cc(C)ccn2)C1 |
| InChI | InChI=1S/C12H18N2.2C2H6/c1-3-11-5-7-14(9-11)12-8-10(2)4-6-13-12;2*1-2/h4,6,8,11H,3,5,7,9H2,1-2H3;2*1-2H3 |
| InChIKey | ICWUVEBFVSELLM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |