About N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine
N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine (PubChem CID 143465241) has the molecular formula C13H22N4
and a molecular weight of 234.35 g/mol. Its IUPAC name is N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine.
Molecular Properties
| Compound Name | N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine |
| PubChem CID | 143465241 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine |
| SMILES | C=NC.Cc1ccnc(N2CCC(N)CC2)c1 |
| InChI | InChI=1S/C11H17N3.C2H5N/c1-9-2-5-13-11(8-9)14-6-3-10(12)4-7-14;1-3-2/h2,5,8,10H,3-4,6-7,12H2,1H3;1H2,2H3 |
| InChIKey | VKWKQMOZTSFYTE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine?
The IUPAC name of N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine (CID 143465241) is N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine.
What is the SMILES notation for N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine?
The canonical SMILES for N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine is C=NC.Cc1ccnc(N2CCC(N)CC2)c1.
What is the InChIKey of N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine?
The InChIKey is VKWKQMOZTSFYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3.C2H5N/c1-9-2-5-13-11(8-9)14-6-3-10(12)4-7-14;1-3-2/h2,5,8,10H,3-4,6-7,12H2,1H3;1H2,2H3.
What are the key properties of N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine?
N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine has a molecular weight of 234.35 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanimine;1-(4-methyl-2-pyridinyl)piperidin-4-amine is sourced from PubChem (CID 143465241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).