C18H32N2O3 — CID 91660354
tert-butyl 2-[1-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]ethyl]piperidine-1-carboxylate (PubChem CID 91660354) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is tert-butyl 2-[1-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[1-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91660354 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | tert-butyl 2-[1-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(N[C@@H]1C=C[C@H](CO)C1)C1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O3/c1-13(19-15-9-8-14(11-15)12-21)16-7-5-6-10-20(16)17(22)23-18(2,3)4/h8-9,13-16,19,21H,5-7,10-12H2,1-4H3/t13?,14-,15+,16?/m0/s1 |
| InChIKey | QCZBILRXHMYNOL-PWUWZPNHSA-N |
| XLogP | 2.69 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|