C19H22ClN3O — CID 91660684
[4-[(4-chloro-2-methylphenyl)methylamino]piperidin-1-yl]-pyridin-4-ylmethanone (PubChem CID 91660684) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is [4-[(4-chloro-2-methylphenyl)methylamino]piperidin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [4-[(4-chloro-2-methylphenyl)methylamino]piperidin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 91660684 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [4-[(4-chloro-2-methylphenyl)methylamino]piperidin-1-yl]-pyridin-4-ylmethanone |
| SMILES | Cc1cc(Cl)ccc1CNC1CCN(C(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C19H22ClN3O/c1-14-12-17(20)3-2-16(14)13-22-18-6-10-23(11-7-18)19(24)15-4-8-21-9-5-15/h2-5,8-9,12,18,22H,6-7,10-11,13H2,1H3 |
| InChIKey | ZCRUKGHXXQOXIT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |