C15H23FN2O3S — CID 91661909
N-[1-[3-(3-fluoro-4-methoxyphenyl)propyl]pyrrolidin-3-yl]methanesulfonamide (PubChem CID 91661909) has the molecular formula C15H23FN2O3S and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[1-[3-(3-fluoro-4-methoxyphenyl)propyl]pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-[3-(3-fluoro-4-methoxyphenyl)propyl]pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 91661909 |
| Molecular Formula | C15H23FN2O3S |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-[1-[3-(3-fluoro-4-methoxyphenyl)propyl]pyrrolidin-3-yl]methanesulfonamide |
| SMILES | COc1ccc(CCCN2CCC(NS(C)(=O)=O)C2)cc1F |
| InChI | InChI=1S/C15H23FN2O3S/c1-21-15-6-5-12(10-14(15)16)4-3-8-18-9-7-13(11-18)17-22(2,19)20/h5-6,10,13,17H,3-4,7-9,11H2,1-2H3 |
| InChIKey | KDEIPVGEMDTNLL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |