C11H12BrF3N2O2 — CID 91662216
3-(2-bromo-4-methoxyphenyl)-1-methyl-1-(2,2,2-trifluoroethyl)urea (PubChem CID 91662216) has the molecular formula C11H12BrF3N2O2 and a molecular weight of 341.13 g/mol. Its IUPAC name is 3-(2-bromo-4-methoxyphenyl)-1-methyl-1-(2,2,2-trifluoroethyl)urea.
| Compound Name | 3-(2-bromo-4-methoxyphenyl)-1-methyl-1-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 91662216 |
| Molecular Formula | C11H12BrF3N2O2 |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 3-(2-bromo-4-methoxyphenyl)-1-methyl-1-(2,2,2-trifluoroethyl)urea |
| SMILES | COc1ccc(NC(=O)N(C)CC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H12BrF3N2O2/c1-17(6-11(13,14)15)10(18)16-9-4-3-7(19-2)5-8(9)12/h3-5H,6H2,1-2H3,(H,16,18) |
| InChIKey | CAMRYWDKFYGYRM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |