C12H6O4 — CID 91664831
4-(3,4-dioxocyclohexa-1,5-dien-1-yl)cyclohexa-3,5-diene-1,2-dione (PubChem CID 91664831) has the molecular formula C12H6O4 and a molecular weight of 214.18 g/mol. Its IUPAC name is 4-(3,4-dioxocyclohexa-1,5-dien-1-yl)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-(3,4-dioxocyclohexa-1,5-dien-1-yl)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 91664831 |
| Molecular Formula | C12H6O4 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 4-(3,4-dioxocyclohexa-1,5-dien-1-yl)cyclohexa-3,5-diene-1,2-dione |
| SMILES | O=C1C=CC(C2=CC(=O)C(=O)C=C2)=CC1=O |
| InChI | InChI=1S/C12H6O4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H |
| InChIKey | AQVVFOZXKZKRPF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|