C22H21BNO3- — CID 91667235
(3S)-2,2,3-triphenyl-1,6,9-trioxa-4-aza-5-boranuidaspiro[4.4]nonane (PubChem CID 91667235) has the molecular formula C22H21BNO3- and a molecular weight of 358.23 g/mol. Its IUPAC name is (3S)-2,2,3-triphenyl-1,6,9-trioxa-4-aza-5-boranuidaspiro[4.4]nonane.
| Compound Name | (3S)-2,2,3-triphenyl-1,6,9-trioxa-4-aza-5-boranuidaspiro[4.4]nonane |
|---|---|
| PubChem CID | 91667235 |
| Molecular Formula | C22H21BNO3- |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (3S)-2,2,3-triphenyl-1,6,9-trioxa-4-aza-5-boranuidaspiro[4.4]nonane |
| SMILES | c1ccc([C@@H]2N[B-]3(OCCO3)OC2(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21BNO3/c1-4-10-18(11-5-1)21-22(19-12-6-2-7-13-19,20-14-8-3-9-15-20)27-23(24-21)25-16-17-26-23/h1-15,21,24H,16-17H2/q-1/t21-/m0/s1 |
| InChIKey | JIEHTNXHHNVAMP-NRFANRHFSA-N |
| XLogP | 3.77 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|