C21H17NOS — CID 139721596
(4R)-4,5,5-triphenyl-1,3-oxazolidine-2-thione (PubChem CID 139721596) has the molecular formula C21H17NOS and a molecular weight of 331.44 g/mol. Its IUPAC name is (4R)-4,5,5-triphenyl-1,3-oxazolidine-2-thione.
| Compound Name | (4R)-4,5,5-triphenyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 139721596 |
| Molecular Formula | C21H17NOS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (4R)-4,5,5-triphenyl-1,3-oxazolidine-2-thione |
| SMILES | S=C1N[C@H](c2ccccc2)C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C21H17NOS/c24-20-22-19(16-10-4-1-5-11-16)21(23-20,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H,(H,22,24)/t19-/m1/s1 |
| InChIKey | VOPSZVOUEITNLA-LJQANCHMSA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|