C15H16N2OS — CID 6543454
(4R,5R)-5-methyl-5-(1-methylpyrrol-2-yl)-4-phenyl-1,3-oxazolidine-2-thione (PubChem CID 6543454) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is (4R,5R)-5-methyl-5-(1-methylpyrrol-2-yl)-4-phenyl-1,3-oxazolidine-2-thione.
| Compound Name | (4R,5R)-5-methyl-5-(1-methylpyrrol-2-yl)-4-phenyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 6543454 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (4R,5R)-5-methyl-5-(1-methylpyrrol-2-yl)-4-phenyl-1,3-oxazolidine-2-thione |
| SMILES | Cn1cccc1[C@]1(C)OC(=S)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H16N2OS/c1-15(12-9-6-10-17(12)2)13(16-14(19)18-15)11-7-4-3-5-8-11/h3-10,13H,1-2H3,(H,16,19)/t13-,15+/m1/s1 |
| InChIKey | UZKBROIXZXQJFV-HIFRSBDPSA-N |
| XLogP | 2.89 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|