About dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane
dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane (PubChem CID 91668067) has the molecular formula C10H25Cl5O4Si2
and a molecular weight of 442.74 g/mol. Its IUPAC name is dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane.
Molecular Properties
| Compound Name | dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane |
| PubChem CID | 91668067 |
| Molecular Formula | C10H25Cl5O4Si2 |
| Molecular Weight | 442.74 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane |
| SMILES | COCCOCCOCCO.C[Si](C)(Cl)Cl.C[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C7H16O4.C2H6Cl2Si.CH3Cl3Si/c1-9-4-5-11-7-6-10-3-2-8;2*1-5(2,3)4/h8H,2-7H2,1H3;1-2H3;1H3 |
| InChIKey | ISPZVYIVFKPYQE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane?
The IUPAC name of dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane (CID 91668067) is dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane.
What is the SMILES notation for dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane?
The canonical SMILES for dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane is COCCOCCOCCO.C[Si](C)(Cl)Cl.C[Si](Cl)(Cl)Cl.
What is the InChIKey of dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane?
The InChIKey is ISPZVYIVFKPYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O4.C2H6Cl2Si.CH3Cl3Si/c1-9-4-5-11-7-6-10-3-2-8;2*1-5(2,3)4/h8H,2-7H2,1H3;1-2H3;1H3.
What are the key properties of dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane?
dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane has a molecular weight of 442.74 g/mol, XLogP of 4.10, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(dimethyl)silane;2-[2-(2-methoxyethoxy)ethoxy]ethanol;trichloro(methyl)silane is sourced from PubChem (CID 91668067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).