About diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol
diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 175583164) has the molecular formula C13H30N3O7+
and a molecular weight of 340.40 g/mol. Its IUPAC name is diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
Molecular Properties
| Compound Name | diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| PubChem CID | 175583164 |
| Molecular Formula | C13H30N3O7+ |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | COCCOCCOCCOCCOCCOCCO.N=[N+]=N |
| InChI | InChI=1S/C13H28O7.H2N3/c1-15-4-5-17-8-9-19-12-13-20-11-10-18-7-6-16-3-2-14;1-3-2/h14H,2-13H2,1H3;1-2H/q;+1 |
| InChIKey | UYIWNWXOMYKVLR-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol?
The IUPAC name of diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CID 175583164) is diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
What is the SMILES notation for diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol?
The canonical SMILES for diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol is COCCOCCOCCOCCOCCOCCO.N=[N+]=N.
What is the InChIKey of diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol?
The InChIKey is UYIWNWXOMYKVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O7.H2N3/c1-15-4-5-17-8-9-19-12-13-20-11-10-18-7-6-16-3-2-14;1-3-2/h14H,2-13H2,1H3;1-2H/q;+1.
What are the key properties of diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol?
diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol has a molecular weight of 340.40 g/mol, XLogP of -0.18, 17 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diiminoazanium;2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol is sourced from PubChem (CID 175583164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).