C44H84N4+2 — CID 91668092
2-[(E)-heptadec-8-enyl]-1-[2-[2-[(E)-heptadec-8-enyl]-3-methyl-4,5-dihydroimidazol-3-ium-1-yl]ethyl]-3-methyl-4,5-dihydroimidazol-3-ium (PubChem CID 91668092) has the molecular formula C44H84N4+2 and a molecular weight of 669.18 g/mol. Its IUPAC name is 2-[(E)-heptadec-8-enyl]-1-[2-[2-[(E)-heptadec-8-enyl]-3-methyl-4,5-dihydroimidazol-3-ium-1-yl]ethyl]-3-methyl-4,5-dihydroimidazol-3-ium.
| Compound Name | 2-[(E)-heptadec-8-enyl]-1-[2-[2-[(E)-heptadec-8-enyl]-3-methyl-4,5-dihydroimidazol-3-ium-1-yl]ethyl]-3-methyl-4,5-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 91668092 |
| Molecular Formula | C44H84N4+2 |
| Molecular Weight | 669.18 g/mol |
| Exact Mass | 668.67 |
| IUPAC Name | 2-[(E)-heptadec-8-enyl]-1-[2-[2-[(E)-heptadec-8-enyl]-3-methyl-4,5-dihydroimidazol-3-ium-1-yl]ethyl]-3-methyl-4,5-dihydroimidazol-3-ium |
| SMILES | CCCCCCCC/C=C/CCCCCCCC1=[N+](C)CCN1CCN1CC[N+](C)=C1CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C44H84N4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-43-45(3)37-39-47(43)41-42-48-40-38-46(4)44(48)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22H,5-18,23-42H2,1-4H3/q+2/b21-19+,22-20+ |
| InChIKey | WJRXWPUNKJHOFE-FLFKKZLDSA-N |
| XLogP | 11.77 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.18 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|