C16H25IN2O3S — CID 91670076
5-iodo-2-methoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide (PubChem CID 91670076) has the molecular formula C16H25IN2O3S and a molecular weight of 452.36 g/mol. Its IUPAC name is 5-iodo-2-methoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 5-iodo-2-methoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 91670076 |
| Molecular Formula | C16H25IN2O3S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 5-iodo-2-methoxy-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide |
| SMILES | COc1ccc(I)cc1S(=O)(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C16H25IN2O3S/c1-15(2)9-12(10-16(3,4)19-15)18-23(20,21)14-8-11(17)6-7-13(14)22-5/h6-8,12,18-19H,9-10H2,1-5H3 |
| InChIKey | BDJOEGHDAORXSQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|