C11H18O3 — CID 91670731
(4R,5R,6R)-8-oxaspiro[5.6]dodec-10-ene-4,5-diol (PubChem CID 91670731) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (4R,5R,6R)-8-oxaspiro[5.6]dodec-10-ene-4,5-diol.
| Compound Name | (4R,5R,6R)-8-oxaspiro[5.6]dodec-10-ene-4,5-diol |
|---|---|
| PubChem CID | 91670731 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (4R,5R,6R)-8-oxaspiro[5.6]dodec-10-ene-4,5-diol |
| SMILES | O[C@@H]1CCC[C@]2(CC=CCOC2)[C@H]1O |
| InChI | InChI=1S/C11H18O3/c12-9-4-3-6-11(10(9)13)5-1-2-7-14-8-11/h1-2,9-10,12-13H,3-8H2/t9-,10+,11+/m1/s1 |
| InChIKey | ISFGCZDZUUACJB-VWYCJHECSA-N |
| XLogP | 0.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|