C17H17N3O2 — CID 91673348
(7-amino-2,3-dihydro-1,4-benzodiazepin-1-yl)-(2-methoxyphenyl)methanone (PubChem CID 91673348) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is (7-amino-2,3-dihydro-1,4-benzodiazepin-1-yl)-(2-methoxyphenyl)methanone.
| Compound Name | (7-amino-2,3-dihydro-1,4-benzodiazepin-1-yl)-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 91673348 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (7-amino-2,3-dihydro-1,4-benzodiazepin-1-yl)-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)N1CCN=Cc2cc(N)ccc21 |
| InChI | InChI=1S/C17H17N3O2/c1-22-16-5-3-2-4-14(16)17(21)20-9-8-19-11-12-10-13(18)6-7-15(12)20/h2-7,10-11H,8-9,18H2,1H3 |
| InChIKey | VDZKESOUAMITEA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|