C17H21N3O2 — CID 91674479
N-[[4-(dimethylamino)-3-nitrophenyl]methyl]-2,5-dimethylaniline (PubChem CID 91674479) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[[4-(dimethylamino)-3-nitrophenyl]methyl]-2,5-dimethylaniline.
| Compound Name | N-[[4-(dimethylamino)-3-nitrophenyl]methyl]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 91674479 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[[4-(dimethylamino)-3-nitrophenyl]methyl]-2,5-dimethylaniline |
| SMILES | Cc1ccc(C)c(NCc2ccc(N(C)C)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C17H21N3O2/c1-12-5-6-13(2)15(9-12)18-11-14-7-8-16(19(3)4)17(10-14)20(21)22/h5-10,18H,11H2,1-4H3 |
| InChIKey | WVQFSRIRJHUUIG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|