C19H25N3O2 — CID 91674483
4-[(3,5-dimethylanilino)methyl]-N,N-diethyl-2-nitroaniline (PubChem CID 91674483) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[(3,5-dimethylanilino)methyl]-N,N-diethyl-2-nitroaniline.
| Compound Name | 4-[(3,5-dimethylanilino)methyl]-N,N-diethyl-2-nitroaniline |
|---|---|
| PubChem CID | 91674483 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-[(3,5-dimethylanilino)methyl]-N,N-diethyl-2-nitroaniline |
| SMILES | CCN(CC)c1ccc(CNc2cc(C)cc(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H25N3O2/c1-5-21(6-2)18-8-7-16(12-19(18)22(23)24)13-20-17-10-14(3)9-15(4)11-17/h7-12,20H,5-6,13H2,1-4H3 |
| InChIKey | XJJXWPPIVZSSHJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|