C17H21F3N2O3 — CID 91677120
methyl 2-(4-methylpiperidin-1-yl)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 91677120) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is methyl 2-(4-methylpiperidin-1-yl)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | methyl 2-(4-methylpiperidin-1-yl)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 91677120 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | methyl 2-(4-methylpiperidin-1-yl)-5-[methyl-(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | COC(=O)c1cc(N(C)C(=O)C(F)(F)F)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-11-6-8-22(9-7-11)14-5-4-12(10-13(14)15(23)25-3)21(2)16(24)17(18,19)20/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | AUVFDKZUVWWJCA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|