C19H21BN3O3- — CID 88958591
CID 88958591 (PubChem CID 88958591) has the molecular formula C19H21BN3O3- and a molecular weight of 350.21 g/mol.
| Compound Name | CID 88958591 |
|---|---|
| PubChem CID | 88958591 |
| Molecular Formula | C19H21BN3O3- |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)c2cc(N([O-])O)ccc2N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C19H21BN3O3/c1-13-8-10-22(11-9-13)18-7-6-16(23(25)26)12-17(18)19(24)21-15-4-2-14(20)3-5-15/h2-7,12-13,25H,8-11H2,1H3,(H,21,24)/q-1 |
| InChIKey | VPPBVACEFJRVLT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|