C20H22O8S — CID 91678161
3-methoxy-5-(methylsulfanylmethyl)-4-(3,4,5-trimethoxybenzoyl)oxybenzoic acid (PubChem CID 91678161) has the molecular formula C20H22O8S and a molecular weight of 422.46 g/mol. Its IUPAC name is 3-methoxy-5-(methylsulfanylmethyl)-4-(3,4,5-trimethoxybenzoyl)oxybenzoic acid.
| Compound Name | 3-methoxy-5-(methylsulfanylmethyl)-4-(3,4,5-trimethoxybenzoyl)oxybenzoic acid |
|---|---|
| PubChem CID | 91678161 |
| Molecular Formula | C20H22O8S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-methoxy-5-(methylsulfanylmethyl)-4-(3,4,5-trimethoxybenzoyl)oxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(CSC)c1OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H22O8S/c1-24-14-7-11(19(21)22)6-13(10-29-5)17(14)28-20(23)12-8-15(25-2)18(27-4)16(9-12)26-3/h6-9H,10H2,1-5H3,(H,21,22) |
| InChIKey | CJSAXMFOBVHDIA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|