C14H18O5S — CID 91678101
4-butanoyloxy-3-methoxy-5-(methylsulfanylmethyl)benzoic acid (PubChem CID 91678101) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is 4-butanoyloxy-3-methoxy-5-(methylsulfanylmethyl)benzoic acid.
| Compound Name | 4-butanoyloxy-3-methoxy-5-(methylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 91678101 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 4-butanoyloxy-3-methoxy-5-(methylsulfanylmethyl)benzoic acid |
| SMILES | CCCC(=O)Oc1c(CSC)cc(C(=O)O)cc1OC |
| InChI | InChI=1S/C14H18O5S/c1-4-5-12(15)19-13-10(8-20-3)6-9(14(16)17)7-11(13)18-2/h6-7H,4-5,8H2,1-3H3,(H,16,17) |
| InChIKey | APHODQWFUHNYPZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|