C18H15N3O3S — CID 91680637
N-(2-amino-4-ethoxy-1,3-benzothiazol-6-yl)-1-benzofuran-2-carboxamide (PubChem CID 91680637) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is N-(2-amino-4-ethoxy-1,3-benzothiazol-6-yl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-amino-4-ethoxy-1,3-benzothiazol-6-yl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 91680637 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-(2-amino-4-ethoxy-1,3-benzothiazol-6-yl)-1-benzofuran-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2cc3ccccc3o2)cc2sc(N)nc12 |
| InChI | InChI=1S/C18H15N3O3S/c1-2-23-13-8-11(9-15-16(13)21-18(19)25-15)20-17(22)14-7-10-5-3-4-6-12(10)24-14/h3-9H,2H2,1H3,(H2,19,21)(H,20,22) |
| InChIKey | DCKGIBAABRXKAF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |