C18H19ClN4O2S — CID 91680974
2-(4-chlorophenoxy)-N-(2-hydrazinyl-4-methyl-1,3-benzothiazol-6-yl)-2-methylpropanamide (PubChem CID 91680974) has the molecular formula C18H19ClN4O2S and a molecular weight of 390.90 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(2-hydrazinyl-4-methyl-1,3-benzothiazol-6-yl)-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(2-hydrazinyl-4-methyl-1,3-benzothiazol-6-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 91680974 |
| Molecular Formula | C18H19ClN4O2S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(2-hydrazinyl-4-methyl-1,3-benzothiazol-6-yl)-2-methylpropanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)Oc2ccc(Cl)cc2)cc2sc(NN)nc12 |
| InChI | InChI=1S/C18H19ClN4O2S/c1-10-8-12(9-14-15(10)22-17(23-20)26-14)21-16(24)18(2,3)25-13-6-4-11(19)5-7-13/h4-9H,20H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | BDDZMWONAMFQQJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|