C17H16Cl2N4O2S — CID 99966912
(2S)-2-(2,4-dichlorophenoxy)-N-(2-hydrazinyl-4-methyl-1,3-benzothiazol-6-yl)propanamide (PubChem CID 99966912) has the molecular formula C17H16Cl2N4O2S and a molecular weight of 411.31 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N-(2-hydrazinyl-4-methyl-1,3-benzothiazol-6-yl)propanamide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N-(2-hydrazinyl-4-methyl-1,3-benzothiazol-6-yl)propanamide |
|---|---|
| PubChem CID | 99966912 |
| Molecular Formula | C17H16Cl2N4O2S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N-(2-hydrazinyl-4-methyl-1,3-benzothiazol-6-yl)propanamide |
| SMILES | Cc1cc(NC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)cc2sc(NN)nc12 |
| InChI | InChI=1S/C17H16Cl2N4O2S/c1-8-5-11(7-14-15(8)22-17(23-20)26-14)21-16(24)9(2)25-13-4-3-10(18)6-12(13)19/h3-7,9H,20H2,1-2H3,(H,21,24)(H,22,23)/t9-/m0/s1 |
| InChIKey | MCNBQWHKNMWGCB-VIFPVBQESA-N |
| XLogP | 4.60 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|