C14H9Cl3N2O3 — CID 91682684
2,4-dichloro-5-[(3-chlorophenyl)carbamoylamino]benzoic acid (PubChem CID 91682684) has the molecular formula C14H9Cl3N2O3 and a molecular weight of 359.60 g/mol. Its IUPAC name is 2,4-dichloro-5-[(3-chlorophenyl)carbamoylamino]benzoic acid.
| Compound Name | 2,4-dichloro-5-[(3-chlorophenyl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 91682684 |
| Molecular Formula | C14H9Cl3N2O3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 2,4-dichloro-5-[(3-chlorophenyl)carbamoylamino]benzoic acid |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl3N2O3/c15-7-2-1-3-8(4-7)18-14(22)19-12-5-9(13(20)21)10(16)6-11(12)17/h1-6H,(H,20,21)(H2,18,19,22) |
| InChIKey | UJXMHIZVRBGDGK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |