C12H11ClN4O3 — CID 19447892
4-[(3-chlorophenyl)carbamoylamino]-1-methylpyrazole-5-carboxylic acid (PubChem CID 19447892) has the molecular formula C12H11ClN4O3 and a molecular weight of 294.70 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)carbamoylamino]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-[(3-chlorophenyl)carbamoylamino]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19447892 |
| Molecular Formula | C12H11ClN4O3 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 4-[(3-chlorophenyl)carbamoylamino]-1-methylpyrazole-5-carboxylic acid |
| SMILES | Cn1ncc(NC(=O)Nc2cccc(Cl)c2)c1C(=O)O |
| InChI | InChI=1S/C12H11ClN4O3/c1-17-10(11(18)19)9(6-14-17)16-12(20)15-8-4-2-3-7(13)5-8/h2-6H,1H3,(H,18,19)(H2,15,16,20) |
| InChIKey | KYIRUFNKHFYZEI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |