C13H12F3N5O2 — CID 17381795
1-methyl-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]pyrazole-5-carboxamide (PubChem CID 17381795) has the molecular formula C13H12F3N5O2 and a molecular weight of 327.27 g/mol. Its IUPAC name is 1-methyl-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]pyrazole-5-carboxamide.
| Compound Name | 1-methyl-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 17381795 |
| Molecular Formula | C13H12F3N5O2 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 1-methyl-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]pyrazole-5-carboxamide |
| SMILES | Cn1ncc(NC(=O)Nc2cccc(C(F)(F)F)c2)c1C(N)=O |
| InChI | InChI=1S/C13H12F3N5O2/c1-21-10(11(17)22)9(6-18-21)20-12(23)19-8-4-2-3-7(5-8)13(14,15)16/h2-6H,1H3,(H2,17,22)(H2,19,20,23) |
| InChIKey | YPQTZGLKOJSNKX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |