C19H19ClN2O5 — CID 91683567
2-chloro-N-[7-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-5-yl]acetamide (PubChem CID 91683567) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is 2-chloro-N-[7-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-5-yl]acetamide.
| Compound Name | 2-chloro-N-[7-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 91683567 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-chloro-N-[7-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-5-yl]acetamide |
| SMILES | COc1cc(-c2nc3cc(NC(=O)CCl)cc(C)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19ClN2O5/c1-10-5-12(21-16(23)9-20)8-13-17(10)27-19(22-13)11-6-14(24-2)18(26-4)15(7-11)25-3/h5-8H,9H2,1-4H3,(H,21,23) |
| InChIKey | XALOGMHKJWJULN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|