C19H18BrNO4 — CID 91685340
prop-2-enyl (E)-3-[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoate (PubChem CID 91685340) has the molecular formula C19H18BrNO4 and a molecular weight of 404.26 g/mol. Its IUPAC name is prop-2-enyl (E)-3-[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoate.
| Compound Name | prop-2-enyl (E)-3-[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91685340 |
| Molecular Formula | C19H18BrNO4 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | prop-2-enyl (E)-3-[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoate |
| SMILES | C=CCOC(=O)/C=C/c1cc(Br)c(OCc2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C19H18BrNO4/c1-3-9-24-18(22)7-6-14-10-16(20)19(17(11-14)23-2)25-13-15-5-4-8-21-12-15/h3-8,10-12H,1,9,13H2,2H3/b7-6+ |
| InChIKey | WQTSGQTUDRDGEC-VOTSOKGWSA-N |
| XLogP | 4.17 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|