3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride

C18H11BrCl2O2 — CID 91686017

IUPAC3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride
SMILESO=C(Cl)c1cc(Cl)c(OCc2cccc3ccccc23)c(Br)c1
InChIInChI=1S/C18H11BrCl2O2/c19-15-8-13(18(21)22)9-16(20)17(15)23-10-12-6-3-5-11-4-1-2-7-14(11)12/h1-9H,10H2
InChIKeyCAIJZMDCVDNGRB-UHFFFAOYSA-N
MW410.09 g/mol
LogP6.21
Rot. Bonds4

About 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride

3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride (PubChem CID 91686017) has the molecular formula C18H11BrCl2O2 and a molecular weight of 410.09 g/mol. Its IUPAC name is 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride.

Molecular Properties

Compound Name3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride
PubChem CID91686017
Molecular FormulaC18H11BrCl2O2
Molecular Weight410.09 g/mol
Exact Mass407.93
IUPAC Name3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride
SMILESO=C(Cl)c1cc(Cl)c(OCc2cccc3ccccc23)c(Br)c1
InChIInChI=1S/C18H11BrCl2O2/c19-15-8-13(18(21)22)9-16(20)17(15)23-10-12-6-3-5-11-4-1-2-7-14(11)12/h1-9H,10H2
InChIKeyCAIJZMDCVDNGRB-UHFFFAOYSA-N
XLogP6.21
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500410.09
LogP ≤ 56.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride?
The IUPAC name of 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride (CID 91686017) is 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride.
What is the SMILES notation for 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride?
The canonical SMILES for 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride is O=C(Cl)c1cc(Cl)c(OCc2cccc3ccccc23)c(Br)c1.
What is the InChIKey of 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride?
The InChIKey is CAIJZMDCVDNGRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11BrCl2O2/c19-15-8-13(18(21)22)9-16(20)17(15)23-10-12-6-3-5-11-4-1-2-7-14(11)12/h1-9H,10H2.
What are the key properties of 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride?
3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride has a molecular weight of 410.09 g/mol, XLogP of 6.21, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-chloro-4-(naphthalen-1-ylmethoxy)benzoyl chloride is sourced from PubChem (CID 91686017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).