C15H20N2O2S — CID 91687016
3-(cyclohexylcarbamothioylamino)-2-methylbenzoic acid (PubChem CID 91687016) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 3-(cyclohexylcarbamothioylamino)-2-methylbenzoic acid.
| Compound Name | 3-(cyclohexylcarbamothioylamino)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 91687016 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-(cyclohexylcarbamothioylamino)-2-methylbenzoic acid |
| SMILES | Cc1c(NC(=S)NC2CCCCC2)cccc1C(=O)O |
| InChI | InChI=1S/C15H20N2O2S/c1-10-12(14(18)19)8-5-9-13(10)17-15(20)16-11-6-3-2-4-7-11/h5,8-9,11H,2-4,6-7H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | NEHUNLFLVYIANO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|