C12H15N5O4 — CID 91689185
5-[4-(3-methoxypropylamino)-3-nitrophenyl]-1,3,4-oxadiazol-2-amine (PubChem CID 91689185) has the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. Its IUPAC name is 5-[4-(3-methoxypropylamino)-3-nitrophenyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[4-(3-methoxypropylamino)-3-nitrophenyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 91689185 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 5-[4-(3-methoxypropylamino)-3-nitrophenyl]-1,3,4-oxadiazol-2-amine |
| SMILES | COCCCNc1ccc(-c2nnc(N)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N5O4/c1-20-6-2-5-14-9-4-3-8(7-10(9)17(18)19)11-15-16-12(13)21-11/h3-4,7,14H,2,5-6H2,1H3,(H2,13,16) |
| InChIKey | VIQBBCZOKRCMIJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|