C22H15BrN2O — CID 91689291
6-bromo-2-(1,2-dihydroacenaphthylen-5-yl)quinoline-4-carboxamide (PubChem CID 91689291) has the molecular formula C22H15BrN2O and a molecular weight of 403.28 g/mol. Its IUPAC name is 6-bromo-2-(1,2-dihydroacenaphthylen-5-yl)quinoline-4-carboxamide.
| Compound Name | 6-bromo-2-(1,2-dihydroacenaphthylen-5-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 91689291 |
| Molecular Formula | C22H15BrN2O |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 6-bromo-2-(1,2-dihydroacenaphthylen-5-yl)quinoline-4-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc3c4c(cccc24)CC3)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C22H15BrN2O/c23-14-7-9-19-17(10-14)18(22(24)26)11-20(25-19)15-8-6-13-5-4-12-2-1-3-16(15)21(12)13/h1-3,6-11H,4-5H2,(H2,24,26) |
| InChIKey | HWVOHLGEHIIORG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |