C30H26IN3O3S — CID 91690885
3-[(E)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 91690885) has the molecular formula C30H26IN3O3S and a molecular weight of 635.53 g/mol. Its IUPAC name is 3-[(E)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(E)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 91690885 |
| Molecular Formula | C30H26IN3O3S |
| Molecular Weight | 635.53 g/mol |
| Exact Mass | 635.07 |
| IUPAC Name | 3-[(E)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1cc(/C=N/n2cnc3sc4c(c3c2=O)CCCC4)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H26IN3O3S/c1-2-36-25-15-19(14-24(31)28(25)37-17-21-10-7-9-20-8-3-4-11-22(20)21)16-33-34-18-32-29-27(30(34)35)23-12-5-6-13-26(23)38-29/h3-4,7-11,14-16,18H,2,5-6,12-13,17H2,1H3/b33-16+ |
| InChIKey | QVERSKRJLFJOEA-MHDJOFBISA-N |
| XLogP | 6.95 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|