About [(E)-but-2-enyl] propyl carbonate
[(E)-but-2-enyl] propyl carbonate (PubChem CID 91692424) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is [(E)-but-2-enyl] propyl carbonate.
Molecular Properties
| Compound Name | [(E)-but-2-enyl] propyl carbonate |
| PubChem CID | 91692424 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | [(E)-but-2-enyl] propyl carbonate |
| SMILES | C/C=C/COC(=O)OCCC |
| InChI | InChI=1S/C8H14O3/c1-3-5-7-11-8(9)10-6-4-2/h3,5H,4,6-7H2,1-2H3/b5-3+ |
| InChIKey | BILVLOZGIFYROK-HWKANZROSA-N |
| XLogP | 2.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enyl] propyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enyl] propyl carbonate?
The IUPAC name of [(E)-but-2-enyl] propyl carbonate (CID 91692424) is [(E)-but-2-enyl] propyl carbonate.
What is the SMILES notation for [(E)-but-2-enyl] propyl carbonate?
The canonical SMILES for [(E)-but-2-enyl] propyl carbonate is C/C=C/COC(=O)OCCC.
What is the InChIKey of [(E)-but-2-enyl] propyl carbonate?
The InChIKey is BILVLOZGIFYROK-HWKANZROSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-5-7-11-8(9)10-6-4-2/h3,5H,4,6-7H2,1-2H3/b5-3+.
What are the key properties of [(E)-but-2-enyl] propyl carbonate?
[(E)-but-2-enyl] propyl carbonate has a molecular weight of 158.20 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enyl] propyl carbonate is sourced from PubChem (CID 91692424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).