C23H40O4 — CID 91694346
1,3-dimethoxypropan-2-yl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate (PubChem CID 91694346) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is 1,3-dimethoxypropan-2-yl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate.
| Compound Name | 1,3-dimethoxypropan-2-yl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 91694346 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 1,3-dimethoxypropan-2-yl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COC)COC |
| InChI | InChI=1S/C23H40O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(24)27-22(20-25-2)21-26-3/h8-9,11-12,14-15,22H,4-7,10,13,16-21H2,1-3H3/b9-8-,12-11-,15-14- |
| InChIKey | VIKUDDUNJKSMIM-ORZIMQNZSA-N |
| XLogP | 5.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|