C21H34O4 — CID 91694826
4-O-(cyclohexylmethyl) 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] butanedioate (PubChem CID 91694826) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is 4-O-(cyclohexylmethyl) 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] butanedioate.
| Compound Name | 4-O-(cyclohexylmethyl) 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] butanedioate |
|---|---|
| PubChem CID | 91694826 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 4-O-(cyclohexylmethyl) 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] butanedioate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)CCC(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C21H34O4/c1-17(2)8-7-9-18(3)14-15-24-20(22)12-13-21(23)25-16-19-10-5-4-6-11-19/h8,14,19H,4-7,9-13,15-16H2,1-3H3/b18-14+ |
| InChIKey | PDGQJGJZIAJVRG-NBVRZTHBSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|