C20H32O2 — CID 162951635
2-[(1R,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enyl 3-methylbutanoate (PubChem CID 162951635) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-[(1R,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enyl 3-methylbutanoate.
| Compound Name | 2-[(1R,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enyl 3-methylbutanoate |
|---|---|
| PubChem CID | 162951635 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2-[(1R,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]prop-2-enyl 3-methylbutanoate |
| SMILES | C=C(COC(=O)CC(C)C)[C@H]1C/C=C(\C)CC/C=C(\C)CC1 |
| InChI | InChI=1S/C20H32O2/c1-15(2)13-20(21)22-14-18(5)19-11-9-16(3)7-6-8-17(4)10-12-19/h7,10,15,19H,5-6,8-9,11-14H2,1-4H3/b16-7+,17-10+/t19-/m1/s1 |
| InChIKey | DJPPBEMMOBHKTP-LMNIUILOSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|