C25H40O2Si2 — CID 91696786
(10,13-dimethyl-3-trimethylsilyloxy-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthren-17-yl)oxy-trimethylsilane (PubChem CID 91696786) has the molecular formula C25H40O2Si2 and a molecular weight of 428.77 g/mol. Its IUPAC name is (10,13-dimethyl-3-trimethylsilyloxy-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthren-17-yl)oxy-trimethylsilane.
| Compound Name | (10,13-dimethyl-3-trimethylsilyloxy-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthren-17-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 91696786 |
| Molecular Formula | C25H40O2Si2 |
| Molecular Weight | 428.77 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (10,13-dimethyl-3-trimethylsilyloxy-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthren-17-yl)oxy-trimethylsilane |
| SMILES | CC12C=CC(O[Si](C)(C)C)=CC1=CCC1C2CCC2(C)C(O[Si](C)(C)C)=CCC12 |
| InChI | InChI=1S/C25H40O2Si2/c1-24-15-13-19(26-28(3,4)5)17-18(24)9-10-20-21-11-12-23(27-29(6,7)8)25(21,2)16-14-22(20)24/h9,12-13,15,17,20-22H,10-11,14,16H2,1-8H3 |
| InChIKey | FDLXAQMQAOPIDT-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.77 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|