C12H28O2Si2 — CID 91697746
trimethyl-[(1R,3S)-3-trimethylsilyloxycyclohexyl]oxysilane (PubChem CID 91697746) has the molecular formula C12H28O2Si2 and a molecular weight of 260.53 g/mol. Its IUPAC name is trimethyl-[(1R,3S)-3-trimethylsilyloxycyclohexyl]oxysilane.
| Compound Name | trimethyl-[(1R,3S)-3-trimethylsilyloxycyclohexyl]oxysilane |
|---|---|
| PubChem CID | 91697746 |
| Molecular Formula | C12H28O2Si2 |
| Molecular Weight | 260.53 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | trimethyl-[(1R,3S)-3-trimethylsilyloxycyclohexyl]oxysilane |
| SMILES | C[Si](C)(C)O[C@@H]1CCC[C@H](O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C12H28O2Si2/c1-15(2,3)13-11-8-7-9-12(10-11)14-16(4,5)6/h11-12H,7-10H2,1-6H3/t11-,12+ |
| InChIKey | HBTFOMHSIYFXQN-TXEJJXNPSA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|