C13H20Cl2O4 — CID 91697846
5-O-(2,2-dichloroethyl) 1-O-[(Z)-hex-3-enyl] pentanedioate (PubChem CID 91697846) has the molecular formula C13H20Cl2O4 and a molecular weight of 311.21 g/mol. Its IUPAC name is 5-O-(2,2-dichloroethyl) 1-O-[(Z)-hex-3-enyl] pentanedioate.
| Compound Name | 5-O-(2,2-dichloroethyl) 1-O-[(Z)-hex-3-enyl] pentanedioate |
|---|---|
| PubChem CID | 91697846 |
| Molecular Formula | C13H20Cl2O4 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-O-(2,2-dichloroethyl) 1-O-[(Z)-hex-3-enyl] pentanedioate |
| SMILES | CC/C=C\CCOC(=O)CCCC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C13H20Cl2O4/c1-2-3-4-5-9-18-12(16)7-6-8-13(17)19-10-11(14)15/h3-4,11H,2,5-10H2,1H3/b4-3- |
| InChIKey | OLTFUUWZUDOCQS-ARJAWSKDSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|