C11H16Cl2O4 — CID 91705614
1-O-but-3-enyl 5-O-(2,2-dichloroethyl) pentanedioate (PubChem CID 91705614) has the molecular formula C11H16Cl2O4 and a molecular weight of 283.15 g/mol. Its IUPAC name is 1-O-but-3-enyl 5-O-(2,2-dichloroethyl) pentanedioate.
| Compound Name | 1-O-but-3-enyl 5-O-(2,2-dichloroethyl) pentanedioate |
|---|---|
| PubChem CID | 91705614 |
| Molecular Formula | C11H16Cl2O4 |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 1-O-but-3-enyl 5-O-(2,2-dichloroethyl) pentanedioate |
| SMILES | C=CCCOC(=O)CCCC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C11H16Cl2O4/c1-2-3-7-16-10(14)5-4-6-11(15)17-8-9(12)13/h2,9H,1,3-8H2 |
| InChIKey | JUJMHWHBMMRXNP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|