C12H18Cl2O4 — CID 91709063
1-O-(2,2-dichloroethyl) 5-O-pent-4-en-2-yl pentanedioate (PubChem CID 91709063) has the molecular formula C12H18Cl2O4 and a molecular weight of 297.18 g/mol. Its IUPAC name is 1-O-(2,2-dichloroethyl) 5-O-pent-4-en-2-yl pentanedioate.
| Compound Name | 1-O-(2,2-dichloroethyl) 5-O-pent-4-en-2-yl pentanedioate |
|---|---|
| PubChem CID | 91709063 |
| Molecular Formula | C12H18Cl2O4 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 1-O-(2,2-dichloroethyl) 5-O-pent-4-en-2-yl pentanedioate |
| SMILES | C=CCC(C)OC(=O)CCCC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C12H18Cl2O4/c1-3-5-9(2)18-12(16)7-4-6-11(15)17-8-10(13)14/h3,9-10H,1,4-8H2,2H3 |
| InChIKey | UWMODBSUYGPTCV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|