About 2-methylpentyl 6-bromohexanoate
2-methylpentyl 6-bromohexanoate (PubChem CID 91698499) has the molecular formula C12H23BrO2
and a molecular weight of 279.22 g/mol. Its IUPAC name is 2-methylpentyl 6-bromohexanoate.
Molecular Properties
| Compound Name | 2-methylpentyl 6-bromohexanoate |
| PubChem CID | 91698499 |
| Molecular Formula | C12H23BrO2 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-methylpentyl 6-bromohexanoate |
| SMILES | CCCC(C)COC(=O)CCCCCBr |
| InChI | InChI=1S/C12H23BrO2/c1-3-7-11(2)10-15-12(14)8-5-4-6-9-13/h11H,3-10H2,1-2H3 |
| InChIKey | JMGALUFBIWBQEP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentyl 6-bromohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentyl 6-bromohexanoate?
The IUPAC name of 2-methylpentyl 6-bromohexanoate (CID 91698499) is 2-methylpentyl 6-bromohexanoate.
What is the SMILES notation for 2-methylpentyl 6-bromohexanoate?
The canonical SMILES for 2-methylpentyl 6-bromohexanoate is CCCC(C)COC(=O)CCCCCBr.
What is the InChIKey of 2-methylpentyl 6-bromohexanoate?
The InChIKey is JMGALUFBIWBQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23BrO2/c1-3-7-11(2)10-15-12(14)8-5-4-6-9-13/h11H,3-10H2,1-2H3.
What are the key properties of 2-methylpentyl 6-bromohexanoate?
2-methylpentyl 6-bromohexanoate has a molecular weight of 279.22 g/mol, XLogP of 3.92, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentyl 6-bromohexanoate is sourced from PubChem (CID 91698499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).