C16H19Cl3O5 — CID 91699272
hexyl 2-[2-oxo-2-(2,4,6-trichlorophenoxy)ethoxy]acetate (PubChem CID 91699272) has the molecular formula C16H19Cl3O5 and a molecular weight of 397.68 g/mol. Its IUPAC name is hexyl 2-[2-oxo-2-(2,4,6-trichlorophenoxy)ethoxy]acetate.
| Compound Name | hexyl 2-[2-oxo-2-(2,4,6-trichlorophenoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 91699272 |
| Molecular Formula | C16H19Cl3O5 |
| Molecular Weight | 397.68 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | hexyl 2-[2-oxo-2-(2,4,6-trichlorophenoxy)ethoxy]acetate |
| SMILES | CCCCCCOC(=O)COCC(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl3O5/c1-2-3-4-5-6-23-14(20)9-22-10-15(21)24-16-12(18)7-11(17)8-13(16)19/h7-8H,2-6,9-10H2,1H3 |
| InChIKey | LKHKXTBAYIYREV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|