C23H38O4 — CID 91699538
1-O-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl] 5-O-(2-ethylhexyl) pentanedioate (PubChem CID 91699538) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is 1-O-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl] 5-O-(2-ethylhexyl) pentanedioate.
| Compound Name | 1-O-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl] 5-O-(2-ethylhexyl) pentanedioate |
|---|---|
| PubChem CID | 91699538 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 1-O-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl] 5-O-(2-ethylhexyl) pentanedioate |
| SMILES | CCCCC(CC)COC(=O)CCCC(=O)OCC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C23H38O4/c1-5-7-9-17(6-2)15-26-21(24)10-8-11-22(25)27-16-18-12-13-19-14-20(18)23(19,3)4/h12,17,19-20H,5-11,13-16H2,1-4H3 |
| InChIKey | MUXWMNPKPQQYGZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|